C18H16F2N2O — CID 142819388
(5R)-5-fluoro-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazole-5-carbaldehyde (PubChem CID 142819388) has the molecular formula C18H16F2N2O and a molecular weight of 314.33 g/mol. Its IUPAC name is (5R)-5-fluoro-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazole-5-carbaldehyde.
| Compound Name | (5R)-5-fluoro-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazole-5-carbaldehyde |
|---|---|
| PubChem CID | 142819388 |
| Molecular Formula | C18H16F2N2O |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (5R)-5-fluoro-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazole-5-carbaldehyde |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CC[C@]2(F)C=O |
| InChI | InChI=1S/C18H16F2N2O/c1-17-9-12-10-21-22(15-4-2-14(19)3-5-15)16(12)8-13(17)6-7-18(17,20)11-23/h2-5,8,10-11H,6-7,9H2,1H3/t17?,18-/m0/s1 |
| InChIKey | GYWFEUUDPULRRM-ZVAWYAOSSA-N |
| XLogP | 3.66 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|