C20H19FN4OS — CID 11199917
(4aS,5S)-1-(4-fluorophenyl)-4a-methyl-5'-sulfanylidenespiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,4'-imidazolidine]-2'-one (PubChem CID 11199917) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is (4aS,5S)-1-(4-fluorophenyl)-4a-methyl-5'-sulfanylidenespiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,4'-imidazolidine]-2'-one.
| Compound Name | (4aS,5S)-1-(4-fluorophenyl)-4a-methyl-5'-sulfanylidenespiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,4'-imidazolidine]-2'-one |
|---|---|
| PubChem CID | 11199917 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | (4aS,5S)-1-(4-fluorophenyl)-4a-methyl-5'-sulfanylidenespiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,4'-imidazolidine]-2'-one |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC[C@]21NC(=O)NC1=S |
| InChI | InChI=1S/C20H19FN4OS/c1-19-10-12-11-22-25(15-6-4-14(21)5-7-15)16(12)9-13(19)3-2-8-20(19)17(27)23-18(26)24-20/h4-7,9,11H,2-3,8,10H2,1H3,(H2,23,24,26,27)/t19-,20+/m0/s1 |
| InChIKey | UUTCMSXOSVVKNL-VQTJNVASSA-N |
| XLogP | 3.52 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|