C23H27FN2O2 — CID 58713719
(4S,4'aS,6S)-1'-(4-fluorophenyl)-4,4'a,6-trimethylspiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 58713719) has the molecular formula C23H27FN2O2 and a molecular weight of 382.48 g/mol. Its IUPAC name is (4S,4'aS,6S)-1'-(4-fluorophenyl)-4,4'a,6-trimethylspiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4S,4'aS,6S)-1'-(4-fluorophenyl)-4,4'a,6-trimethylspiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 58713719 |
| Molecular Formula | C23H27FN2O2 |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (4S,4'aS,6S)-1'-(4-fluorophenyl)-4,4'a,6-trimethylspiro[1,3-dioxane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | C[C@H]1C[C@H](C)OC2(CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)O1 |
| InChI | InChI=1S/C23H27FN2O2/c1-15-11-16(2)28-23(27-15)10-4-5-18-12-21-17(13-22(18,23)3)14-25-26(21)20-8-6-19(24)7-9-20/h6-9,12,14-16H,4-5,10-11,13H2,1-3H3/t15-,16-,22-/m0/s1 |
| InChIKey | PGEMGHSTYZNZBZ-WCJKSRRJSA-N |
| XLogP | 5.05 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |