C21H21FN2O2 — CID 11302609
(2S,4R,4'aS)-4-ethenyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole] (PubChem CID 11302609) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is (2S,4R,4'aS)-4-ethenyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole].
| Compound Name | (2S,4R,4'aS)-4-ethenyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole] |
|---|---|
| PubChem CID | 11302609 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (2S,4R,4'aS)-4-ethenyl-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-6,7-dihydro-4H-cyclopenta[f]indazole] |
| SMILES | C=C[C@@H]1CO[C@@]2(CCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)O1 |
| InChI | InChI=1S/C21H21FN2O2/c1-3-18-13-25-21(26-18)9-8-15-10-19-14(11-20(15,21)2)12-23-24(19)17-6-4-16(22)5-7-17/h3-7,10,12,18H,1,8-9,11,13H2,2H3/t18-,20+,21+/m1/s1 |
| InChIKey | PBYIXRTVEABHKD-GIVPXCGWSA-N |
| XLogP | 4.05 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|