C19H17FN2O — CID 10267263
(4aS,5R)-5-ethynyl-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol (PubChem CID 10267263) has the molecular formula C19H17FN2O and a molecular weight of 308.36 g/mol. Its IUPAC name is (4aS,5R)-5-ethynyl-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol.
| Compound Name | (4aS,5R)-5-ethynyl-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol |
|---|---|
| PubChem CID | 10267263 |
| Molecular Formula | C19H17FN2O |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (4aS,5R)-5-ethynyl-1-(4-fluorophenyl)-4a-methyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-ol |
| SMILES | C#C[C@]1(O)CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C19H17FN2O/c1-3-19(23)9-8-14-10-17-13(11-18(14,19)2)12-21-22(17)16-6-4-15(20)5-7-16/h1,4-7,10,12,23H,8-9,11H2,2H3/t18-,19-/m0/s1 |
| InChIKey | MRGCFPFDHRMCMZ-OALUTQOASA-N |
| XLogP | 3.12 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|