C21H23FN2O — CID 67475182
[(4aS,5R)-1-(4-fluorophenyl)-4a-methyl-5-prop-2-enyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]methanol (PubChem CID 67475182) has the molecular formula C21H23FN2O and a molecular weight of 338.43 g/mol. Its IUPAC name is [(4aS,5R)-1-(4-fluorophenyl)-4a-methyl-5-prop-2-enyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]methanol.
| Compound Name | [(4aS,5R)-1-(4-fluorophenyl)-4a-methyl-5-prop-2-enyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]methanol |
|---|---|
| PubChem CID | 67475182 |
| Molecular Formula | C21H23FN2O |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [(4aS,5R)-1-(4-fluorophenyl)-4a-methyl-5-prop-2-enyl-6,7-dihydro-4H-cyclopenta[f]indazol-5-yl]methanol |
| SMILES | C=CC[C@]1(CO)CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C |
| InChI | InChI=1S/C21H23FN2O/c1-3-9-21(14-25)10-8-16-11-19-15(12-20(16,21)2)13-23-24(19)18-6-4-17(22)5-7-18/h3-7,11,13,25H,1,8-10,12,14H2,2H3/t20-,21+/m0/s1 |
| InChIKey | BHAHXNHVAMIIRC-LEWJYISDSA-N |
| XLogP | 4.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|