C23H25FN2O — CID 11233850
(4'aS,6R)-1'-(4-fluorophenyl)-3,4'a-dimethylspiro[2,5-dihydropyran-6,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 11233850) has the molecular formula C23H25FN2O and a molecular weight of 364.46 g/mol. Its IUPAC name is (4'aS,6R)-1'-(4-fluorophenyl)-3,4'a-dimethylspiro[2,5-dihydropyran-6,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4'aS,6R)-1'-(4-fluorophenyl)-3,4'a-dimethylspiro[2,5-dihydropyran-6,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 11233850 |
| Molecular Formula | C23H25FN2O |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | (4'aS,6R)-1'-(4-fluorophenyl)-3,4'a-dimethylspiro[2,5-dihydropyran-6,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | CC1=CC[C@@]2(CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)OC1 |
| InChI | InChI=1S/C23H25FN2O/c1-16-9-11-23(27-15-16)10-3-4-18-12-21-17(13-22(18,23)2)14-25-26(21)20-7-5-19(24)6-8-20/h5-9,12,14H,3-4,10-11,13,15H2,1-2H3/t22-,23+/m0/s1 |
| InChIKey | BMWTZYGQKPQGOM-XZOQPEGZSA-N |
| XLogP | 5.25 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|