C35H35FN2O2 — CID 11191851
(4aS,5R)-3',3'-dibenzyl-1-(4-fluorophenyl)-4a-methylspiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,5'-oxolane]-2'-ol (PubChem CID 11191851) has the molecular formula C35H35FN2O2 and a molecular weight of 534.68 g/mol. Its IUPAC name is (4aS,5R)-3',3'-dibenzyl-1-(4-fluorophenyl)-4a-methylspiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,5'-oxolane]-2'-ol.
| Compound Name | (4aS,5R)-3',3'-dibenzyl-1-(4-fluorophenyl)-4a-methylspiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,5'-oxolane]-2'-ol |
|---|---|
| PubChem CID | 11191851 |
| Molecular Formula | C35H35FN2O2 |
| Molecular Weight | 534.68 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | (4aS,5R)-3',3'-dibenzyl-1-(4-fluorophenyl)-4a-methylspiro[4,6,7,8-tetrahydrobenzo[f]indazole-5,5'-oxolane]-2'-ol |
| SMILES | C[C@]12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCC[C@@]21CC(Cc2ccccc2)(Cc2ccccc2)C(O)O1 |
| InChI | InChI=1S/C35H35FN2O2/c1-33-22-27-23-37-38(30-16-14-29(36)15-17-30)31(27)19-28(33)13-8-18-35(33)24-34(32(39)40-35,20-25-9-4-2-5-10-25)21-26-11-6-3-7-12-26/h2-7,9-12,14-17,19,23,32,39H,8,13,18,20-22,24H2,1H3/t32?,33-,35+/m0/s1 |
| InChIKey | NHLVNUWVZMSIFV-KPSRWDKDSA-N |
| XLogP | 7.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.68 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |