C36H35Cl2FN2O4 — CID 58713743
(4R,5R)-4,5-bis[(4-chlorophenyl)methoxymethyl]-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] (PubChem CID 58713743) has the molecular formula C36H35Cl2FN2O4 and a molecular weight of 649.59 g/mol. Its IUPAC name is (4R,5R)-4,5-bis[(4-chlorophenyl)methoxymethyl]-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole].
| Compound Name | (4R,5R)-4,5-bis[(4-chlorophenyl)methoxymethyl]-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
|---|---|
| PubChem CID | 58713743 |
| Molecular Formula | C36H35Cl2FN2O4 |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | (4R,5R)-4,5-bis[(4-chlorophenyl)methoxymethyl]-1'-(4-fluorophenyl)-4'a-methylspiro[1,3-dioxolane-2,5'-4,6,7,8-tetrahydrobenzo[f]indazole] |
| SMILES | CC12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCCC21O[C@H](COCc2ccc(Cl)cc2)[C@@H](COCc2ccc(Cl)cc2)O1 |
| InChI | InChI=1S/C36H35Cl2FN2O4/c1-35-18-26-19-40-41(31-14-12-30(39)13-15-31)32(26)17-27(35)3-2-16-36(35)44-33(22-42-20-24-4-8-28(37)9-5-24)34(45-36)23-43-21-25-6-10-29(38)11-7-25/h4-15,17,19,33-34H,2-3,16,18,20-23H2,1H3/t33-,34-,35?/m1/s1 |
| InChIKey | OGSNHUQYRIIHBG-ORITWGEGSA-N |
| XLogP | 8.36 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |