C25H32FN3OS — CID 142819400
N-[[(4aR)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9-hexahydrocyclohepta[f]indazol-5-yl]methyl]pent-4-enamide;sulfane (PubChem CID 142819400) has the molecular formula C25H32FN3OS and a molecular weight of 441.62 g/mol. Its IUPAC name is N-[[(4aR)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9-hexahydrocyclohepta[f]indazol-5-yl]methyl]pent-4-enamide;sulfane.
| Compound Name | N-[[(4aR)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9-hexahydrocyclohepta[f]indazol-5-yl]methyl]pent-4-enamide;sulfane |
|---|---|
| PubChem CID | 142819400 |
| Molecular Formula | C25H32FN3OS |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | N-[[(4aR)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9-hexahydrocyclohepta[f]indazol-5-yl]methyl]pent-4-enamide;sulfane |
| SMILES | C=CCCC(=O)NCC1CCCCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C.S |
| InChI | InChI=1S/C25H30FN3O.H2S/c1-3-4-9-24(30)27-17-20-8-6-5-7-19-14-23-18(15-25(19,20)2)16-28-29(23)22-12-10-21(26)11-13-22;/h3,10-14,16,20H,1,4-9,15,17H2,2H3,(H,27,30);1H2/t20?,25-;/m0./s1 |
| InChIKey | RPYXSUVHICGAAV-ANXYTEBKSA-N |
| XLogP | 5.34 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|