C27H37FN4O — CID 70825263
3-[1-[(4aR,5R)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]pentan-2-yl]-1,1-diethylurea (PubChem CID 70825263) has the molecular formula C27H37FN4O and a molecular weight of 452.62 g/mol. Its IUPAC name is 3-[1-[(4aR,5R)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]pentan-2-yl]-1,1-diethylurea.
| Compound Name | 3-[1-[(4aR,5R)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]pentan-2-yl]-1,1-diethylurea |
|---|---|
| PubChem CID | 70825263 |
| Molecular Formula | C27H37FN4O |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 3-[1-[(4aR,5R)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]pentan-2-yl]-1,1-diethylurea |
| SMILES | CCCC(C[C@H]1CCC2=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]21C)NC(=O)N(CC)CC |
| InChI | InChI=1S/C27H37FN4O/c1-5-8-23(30-26(33)31(6-2)7-3)15-20-9-10-21-16-25-19(17-27(20,21)4)18-29-32(25)24-13-11-22(28)12-14-24/h11-14,16,18,20,23H,5-10,15,17H2,1-4H3,(H,30,33)/t20-,23?,27-/m1/s1 |
| InChIKey | KYYYZMJWKYURQW-NHXZQCFESA-N |
| XLogP | 5.98 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |