C33H39FN4O — CID 90752301
N-[2-[1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 90752301) has the molecular formula C33H39FN4O and a molecular weight of 526.70 g/mol. Its IUPAC name is N-[2-[1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide.
| Compound Name | N-[2-[1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 90752301 |
| Molecular Formula | C33H39FN4O |
| Molecular Weight | 526.70 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | N-[2-[1-(4-fluorophenyl)-4a-methyl-4,5,6,7-tetrahydrocyclopenta[f]indazol-5-yl]-1-phenylethyl]-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | CC1CC(C)CN(C(=O)NC(CC2CCC3=Cc4c(cnn4-c4ccc(F)cc4)CC32C)c2ccccc2)C1 |
| InChI | InChI=1S/C33H39FN4O/c1-22-15-23(2)21-37(20-22)32(39)36-30(24-7-5-4-6-8-24)16-26-9-10-27-17-31-25(18-33(26,27)3)19-35-38(31)29-13-11-28(34)12-14-29/h4-8,11-14,17,19,22-23,26,30H,9-10,15-16,18,20-21H2,1-3H3,(H,36,39) |
| InChIKey | HZJINTJFDPPJEN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.70 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |