C27H20F4N4O3S — CID 139471730
[1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-oxazol-2-yl)methanone (PubChem CID 139471730) has the molecular formula C27H20F4N4O3S and a molecular weight of 556.54 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-oxazol-2-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-oxazol-2-yl)methanone |
|---|---|
| PubChem CID | 139471730 |
| Molecular Formula | C27H20F4N4O3S |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.12 |
| IUPAC Name | [1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ncco1)C12Cc3cnn(-c4ccc(F)cc4)c3C=C1CCN(S(=O)c1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C27H20F4N4O3S/c28-20-3-5-21(6-4-20)35-23-13-19-9-11-34(39(37)22-7-1-18(2-8-22)27(29,30)31)16-26(19,14-17(23)15-33-35)24(36)25-32-10-12-38-25/h1-8,10,12-13,15H,9,11,14,16H2 |
| InChIKey | KKFLPROEBAIZTN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |