C27H22F4N4O2S2 — CID 139471675
[1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanol (PubChem CID 139471675) has the molecular formula C27H22F4N4O2S2 and a molecular weight of 574.63 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanol.
| Compound Name | [1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanol |
|---|---|
| PubChem CID | 139471675 |
| Molecular Formula | C27H22F4N4O2S2 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | [1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfinyl-4,5,7,8-tetrahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-2-yl)methanol |
| SMILES | O=S(c1ccc(C(F)(F)F)cc1)N1CCC2=Cc3c(cnn3-c3ccc(F)cc3)CC2(C(O)c2nccs2)C1 |
| InChI | InChI=1S/C27H22F4N4O2S2/c28-20-3-5-21(6-4-20)35-23-13-19-9-11-34(39(37)22-7-1-18(2-8-22)27(29,30)31)16-26(19,14-17(23)15-33-35)24(36)25-32-10-12-38-25/h1-8,10,12-13,15,24,36H,9,11,14,16H2 |
| InChIKey | GQUUMWDCSAXYCF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |