C28H31N3O2 — CID 135163518
benzyl (3R)-3-(1-ethyl-4-methylbenzotriazol-5-yl)-3-(3-ethyl-4-methylphenyl)propanoate (PubChem CID 135163518) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is benzyl (3R)-3-(1-ethyl-4-methylbenzotriazol-5-yl)-3-(3-ethyl-4-methylphenyl)propanoate.
| Compound Name | benzyl (3R)-3-(1-ethyl-4-methylbenzotriazol-5-yl)-3-(3-ethyl-4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 135163518 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | benzyl (3R)-3-(1-ethyl-4-methylbenzotriazol-5-yl)-3-(3-ethyl-4-methylphenyl)propanoate |
| SMILES | CCc1cc([C@@H](CC(=O)OCc2ccccc2)c2ccc3c(nnn3CC)c2C)ccc1C |
| InChI | InChI=1S/C28H31N3O2/c1-5-22-16-23(13-12-19(22)3)25(17-27(32)33-18-21-10-8-7-9-11-21)24-14-15-26-28(20(24)4)29-30-31(26)6-2/h7-16,25H,5-6,17-18H2,1-4H3/t25-/m1/s1 |
| InChIKey | XIKXOPGMGAMCPW-RUZDIDTESA-N |
| XLogP | 5.90 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |