C30H36N4O2S — CID 149086103
ethyl 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[[(E)-ethylidene(phenyl)-λ4-sulfanyl]-methylamino]methyl]-4-methylphenyl]propanoate (PubChem CID 149086103) has the molecular formula C30H36N4O2S and a molecular weight of 516.71 g/mol. Its IUPAC name is ethyl 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[[(E)-ethylidene(phenyl)-λ4-sulfanyl]-methylamino]methyl]-4-methylphenyl]propanoate.
| Compound Name | ethyl 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[[(E)-ethylidene(phenyl)-λ4-sulfanyl]-methylamino]methyl]-4-methylphenyl]propanoate |
|---|---|
| PubChem CID | 149086103 |
| Molecular Formula | C30H36N4O2S |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | ethyl 3-(1,4-dimethylbenzotriazol-5-yl)-3-[3-[[[(E)-ethylidene(phenyl)-λ4-sulfanyl]-methylamino]methyl]-4-methylphenyl]propanoate |
| SMILES | C/C=S(\c1ccccc1)N(C)Cc1cc(C(CC(=O)OCC)c2ccc3c(nnn3C)c2C)ccc1C |
| InChI | InChI=1S/C30H36N4O2S/c1-7-36-29(35)19-27(26-16-17-28-30(22(26)4)31-32-34(28)6)23-15-14-21(3)24(18-23)20-33(5)37(8-2)25-12-10-9-11-13-25/h8-18,27H,7,19-20H2,1-6H3 |
| InChIKey | QRGZCKGBFLHAQU-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|