About 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine
6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine (PubChem CID 135163627) has the molecular formula C11H18IN3
and a molecular weight of 319.19 g/mol. Its IUPAC name is 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine |
| PubChem CID | 135163627 |
| Molecular Formula | C11H18IN3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine |
| SMILES | CN1CCNC(C2=NC=C(I)CCC2)C1 |
| InChI | InChI=1S/C11H18IN3/c1-15-6-5-13-11(8-15)10-4-2-3-9(12)7-14-10/h7,11,13H,2-6,8H2,1H3 |
| InChIKey | NAVNMOUGJXNWND-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine?
The IUPAC name of 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine (CID 135163627) is 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine.
What is the SMILES notation for 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine?
The canonical SMILES for 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine is CN1CCNC(C2=NC=C(I)CCC2)C1.
What is the InChIKey of 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine?
The InChIKey is NAVNMOUGJXNWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18IN3/c1-15-6-5-13-11(8-15)10-4-2-3-9(12)7-14-10/h7,11,13H,2-6,8H2,1H3.
What are the key properties of 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine?
6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine has a molecular weight of 319.19 g/mol, XLogP of 1.79, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2-(4-methylpiperazin-2-yl)-4,5-dihydro-3H-azepine is sourced from PubChem (CID 135163627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).