C15H31N3 — CID 142382887
ethane;N-[(Z)-2-methylpent-1-enyl]-1-(4-methylpiperazin-2-yl)ethanimine (PubChem CID 142382887) has the molecular formula C15H31N3 and a molecular weight of 253.43 g/mol. Its IUPAC name is ethane;N-[(Z)-2-methylpent-1-enyl]-1-(4-methylpiperazin-2-yl)ethanimine.
| Compound Name | ethane;N-[(Z)-2-methylpent-1-enyl]-1-(4-methylpiperazin-2-yl)ethanimine |
|---|---|
| PubChem CID | 142382887 |
| Molecular Formula | C15H31N3 |
| Molecular Weight | 253.43 g/mol |
| Exact Mass | 253.25 |
| IUPAC Name | ethane;N-[(Z)-2-methylpent-1-enyl]-1-(4-methylpiperazin-2-yl)ethanimine |
| SMILES | CC.CCC/C(C)=C\N=C(/C)C1CN(C)CCN1 |
| InChI | InChI=1S/C13H25N3.C2H6/c1-5-6-11(2)9-15-12(3)13-10-16(4)8-7-14-13;1-2/h9,13-14H,5-8,10H2,1-4H3;1-2H3/b11-9-,15-12+; |
| InChIKey | QVYIZJWEFWCCRY-JPADGCHBSA-N |
| XLogP | 3.08 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|