C17H20BrN3O — CID 135164649
1-(azetidin-3-yl)-N-[[3-[(2-bromo-3-pyridinyl)methoxy]phenyl]methyl]methanamine (PubChem CID 135164649) has the molecular formula C17H20BrN3O and a molecular weight of 362.27 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-N-[[3-[(2-bromo-3-pyridinyl)methoxy]phenyl]methyl]methanamine.
| Compound Name | 1-(azetidin-3-yl)-N-[[3-[(2-bromo-3-pyridinyl)methoxy]phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 135164649 |
| Molecular Formula | C17H20BrN3O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-(azetidin-3-yl)-N-[[3-[(2-bromo-3-pyridinyl)methoxy]phenyl]methyl]methanamine |
| SMILES | Brc1ncccc1COc1cccc(CNCC2CNC2)c1 |
| InChI | InChI=1S/C17H20BrN3O/c18-17-15(4-2-6-21-17)12-22-16-5-1-3-13(7-16)8-19-9-14-10-20-11-14/h1-7,14,19-20H,8-12H2 |
| InChIKey | KPPTZDMOFXSHES-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|