C22H20O2S3 — CID 135169401
2-[2-[3,5-bis(thiophen-2-ylmethoxy)phenyl]ethyl]thiophene (PubChem CID 135169401) has the molecular formula C22H20O2S3 and a molecular weight of 412.60 g/mol. Its IUPAC name is 2-[2-[3,5-bis(thiophen-2-ylmethoxy)phenyl]ethyl]thiophene.
| Compound Name | 2-[2-[3,5-bis(thiophen-2-ylmethoxy)phenyl]ethyl]thiophene |
|---|---|
| PubChem CID | 135169401 |
| Molecular Formula | C22H20O2S3 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-[2-[3,5-bis(thiophen-2-ylmethoxy)phenyl]ethyl]thiophene |
| SMILES | c1csc(CCc2cc(OCc3cccs3)cc(OCc3cccs3)c2)c1 |
| InChI | InChI=1S/C22H20O2S3/c1-4-20(25-9-1)8-7-17-12-18(23-15-21-5-2-10-26-21)14-19(13-17)24-16-22-6-3-11-27-22/h1-6,9-14H,7-8,15-16H2 |
| InChIKey | VFYMMLZINFGZJW-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |