C8H7NOS2 — CID 54266344
4-(thiophen-2-ylmethoxy)-1,2-thiazole (PubChem CID 54266344) has the molecular formula C8H7NOS2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-(thiophen-2-ylmethoxy)-1,2-thiazole.
| Compound Name | 4-(thiophen-2-ylmethoxy)-1,2-thiazole |
|---|---|
| PubChem CID | 54266344 |
| Molecular Formula | C8H7NOS2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.00 |
| IUPAC Name | 4-(thiophen-2-ylmethoxy)-1,2-thiazole |
| SMILES | c1csc(COc2cnsc2)c1 |
| InChI | InChI=1S/C8H7NOS2/c1-2-8(11-3-1)5-10-7-4-9-12-6-7/h1-4,6H,5H2 |
| InChIKey | IFQRMIMITYUZPD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |