C19H20FN3 — CID 135170065
N-(3-fluorophenyl)-2-[(3Z)-penta-1,3-dien-2-yl]-5,6,7,8-tetrahydroquinazolin-4-amine (PubChem CID 135170065) has the molecular formula C19H20FN3 and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(3-fluorophenyl)-2-[(3Z)-penta-1,3-dien-2-yl]-5,6,7,8-tetrahydroquinazolin-4-amine.
| Compound Name | N-(3-fluorophenyl)-2-[(3Z)-penta-1,3-dien-2-yl]-5,6,7,8-tetrahydroquinazolin-4-amine |
|---|---|
| PubChem CID | 135170065 |
| Molecular Formula | C19H20FN3 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-(3-fluorophenyl)-2-[(3Z)-penta-1,3-dien-2-yl]-5,6,7,8-tetrahydroquinazolin-4-amine |
| SMILES | C=C(/C=C\C)c1nc2c(c(Nc3cccc(F)c3)n1)CCCC2 |
| InChI | InChI=1S/C19H20FN3/c1-3-7-13(2)18-22-17-11-5-4-10-16(17)19(23-18)21-15-9-6-8-14(20)12-15/h3,6-9,12H,2,4-5,10-11H2,1H3,(H,21,22,23)/b7-3- |
| InChIKey | HFNCLUAOACWYQC-CLTKARDFSA-N |
| XLogP | 4.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|