C7H7F5N2OS2 — CID 135170711
5-methyl-3-[2-(1,1,2,2,2-pentafluoroethoxy)ethylsulfanyl]-1,2,4-thiadiazole (PubChem CID 135170711) has the molecular formula C7H7F5N2OS2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 5-methyl-3-[2-(1,1,2,2,2-pentafluoroethoxy)ethylsulfanyl]-1,2,4-thiadiazole.
| Compound Name | 5-methyl-3-[2-(1,1,2,2,2-pentafluoroethoxy)ethylsulfanyl]-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 135170711 |
| Molecular Formula | C7H7F5N2OS2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 293.99 |
| IUPAC Name | 5-methyl-3-[2-(1,1,2,2,2-pentafluoroethoxy)ethylsulfanyl]-1,2,4-thiadiazole |
| SMILES | Cc1nc(SCCOC(F)(F)C(F)(F)F)ns1 |
| InChI | InChI=1S/C7H7F5N2OS2/c1-4-13-5(14-17-4)16-3-2-15-7(11,12)6(8,9)10/h2-3H2,1H3 |
| InChIKey | IBBJQFBSISMMIP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|