C19H22FN3O3S — CID 135171585
[5-[(5-fluoro-2-methoxyphenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 135171585) has the molecular formula C19H22FN3O3S and a molecular weight of 391.47 g/mol. Its IUPAC name is [5-[(5-fluoro-2-methoxyphenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | [5-[(5-fluoro-2-methoxyphenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 135171585 |
| Molecular Formula | C19H22FN3O3S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [5-[(5-fluoro-2-methoxyphenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | COc1ccc(F)cc1SNc1cnc(OC)c(C(=O)N2CCC(C)C2)c1 |
| InChI | InChI=1S/C19H22FN3O3S/c1-12-6-7-23(11-12)19(24)15-9-14(10-21-18(15)26-3)22-27-17-8-13(20)4-5-16(17)25-2/h4-5,8-10,12,22H,6-7,11H2,1-3H3 |
| InChIKey | AKGBXSDDHGHZKV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|