C18H23FN2O4 — CID 38492080
[1-(5-fluoro-2-methoxybenzoyl)piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 38492080) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is [1-(5-fluoro-2-methoxybenzoyl)piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(5-fluoro-2-methoxybenzoyl)piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 38492080 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [1-(5-fluoro-2-methoxybenzoyl)piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccc(F)cc1C(=O)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C18H23FN2O4/c1-24-16-3-2-14(19)12-15(16)18(23)20-6-4-13(5-7-20)17(22)21-8-10-25-11-9-21/h2-3,12-13H,4-11H2,1H3 |
| InChIKey | RQBPASDVWWMFDA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |