C27H25N5O3 — CID 135171848
tert-butyl 2-[3-acetyl-5-(2-methylpyrimidin-5-yl)-6-(2-pyrimidin-5-ylethynyl)indol-1-yl]acetate (PubChem CID 135171848) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is tert-butyl 2-[3-acetyl-5-(2-methylpyrimidin-5-yl)-6-(2-pyrimidin-5-ylethynyl)indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-acetyl-5-(2-methylpyrimidin-5-yl)-6-(2-pyrimidin-5-ylethynyl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 135171848 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | tert-butyl 2-[3-acetyl-5-(2-methylpyrimidin-5-yl)-6-(2-pyrimidin-5-ylethynyl)indol-1-yl]acetate |
| SMILES | CC(=O)c1cn(CC(=O)OC(C)(C)C)c2cc(C#Cc3cncnc3)c(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C27H25N5O3/c1-17(33)24-14-32(15-26(34)35-27(3,4)5)25-8-20(7-6-19-10-28-16-29-11-19)22(9-23(24)25)21-12-30-18(2)31-13-21/h8-14,16H,15H2,1-5H3 |
| InChIKey | CJQYADDHIZZOHA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 99.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|