C27H31N5O3 — CID 166696968
tert-butyl 2-[3-acetyl-5-[(E)-1-[1-(methylideneamino)ethylideneamino]prop-1-en-2-yl]-6-(2-methylpyrimidin-5-yl)indol-1-yl]acetate (PubChem CID 166696968) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is tert-butyl 2-[3-acetyl-5-[(E)-1-[1-(methylideneamino)ethylideneamino]prop-1-en-2-yl]-6-(2-methylpyrimidin-5-yl)indol-1-yl]acetate.
| Compound Name | tert-butyl 2-[3-acetyl-5-[(E)-1-[1-(methylideneamino)ethylideneamino]prop-1-en-2-yl]-6-(2-methylpyrimidin-5-yl)indol-1-yl]acetate |
|---|---|
| PubChem CID | 166696968 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | tert-butyl 2-[3-acetyl-5-[(E)-1-[1-(methylideneamino)ethylideneamino]prop-1-en-2-yl]-6-(2-methylpyrimidin-5-yl)indol-1-yl]acetate |
| SMILES | C=N/C(C)=N/C=C(\C)c1cc2c(C(C)=O)cn(CC(=O)OC(C)(C)C)c2cc1-c1cnc(C)nc1 |
| InChI | InChI=1S/C27H31N5O3/c1-16(11-29-18(3)28-8)21-9-23-24(17(2)33)14-32(15-26(34)35-27(5,6)7)25(23)10-22(21)20-12-30-19(4)31-13-20/h9-14H,8,15H2,1-7H3/b16-11+,29-18+ |
| InChIKey | KCBDXLMBWWMWIU-XJMWCGESSA-N |
| XLogP | 5.43 |
| TPSA | 98.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|