C15H8I2N2 — CID 135172312
2,11-diiodoimidazo[1,2-f]phenanthridine (PubChem CID 135172312) has the molecular formula C15H8I2N2 and a molecular weight of 470.05 g/mol. Its IUPAC name is 2,11-diiodoimidazo[1,2-f]phenanthridine.
| Compound Name | 2,11-diiodoimidazo[1,2-f]phenanthridine |
|---|---|
| PubChem CID | 135172312 |
| Molecular Formula | C15H8I2N2 |
| Molecular Weight | 470.05 g/mol |
| Exact Mass | 469.88 |
| IUPAC Name | 2,11-diiodoimidazo[1,2-f]phenanthridine |
| SMILES | Ic1ccc2c3ccccc3n3cc(I)nc3c2c1 |
| InChI | InChI=1S/C15H8I2N2/c16-9-5-6-10-11-3-1-2-4-13(11)19-8-14(17)18-15(19)12(10)7-9/h1-8H |
| InChIKey | KEUAAMATRYVKAC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.05 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|