C15H10ClF2NO3 — CID 135175541
2-amino-3-(7-chlorodibenzofuran-3-yl)-3,3-difluoropropanoic acid (PubChem CID 135175541) has the molecular formula C15H10ClF2NO3 and a molecular weight of 325.70 g/mol. Its IUPAC name is 2-amino-3-(7-chlorodibenzofuran-3-yl)-3,3-difluoropropanoic acid.
| Compound Name | 2-amino-3-(7-chlorodibenzofuran-3-yl)-3,3-difluoropropanoic acid |
|---|---|
| PubChem CID | 135175541 |
| Molecular Formula | C15H10ClF2NO3 |
| Molecular Weight | 325.70 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 2-amino-3-(7-chlorodibenzofuran-3-yl)-3,3-difluoropropanoic acid |
| SMILES | NC(C(=O)O)C(F)(F)c1ccc2c(c1)oc1cc(Cl)ccc12 |
| InChI | InChI=1S/C15H10ClF2NO3/c16-8-2-4-10-9-3-1-7(5-11(9)22-12(10)6-8)15(17,18)13(19)14(20)21/h1-6,13H,19H2,(H,20,21) |
| InChIKey | QJXWQRYJALUZQY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.70 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |