C12H14ClF2NO3 — CID 153445319
2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoic acid (PubChem CID 153445319) has the molecular formula C12H14ClF2NO3 and a molecular weight of 293.70 g/mol. Its IUPAC name is 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoic acid.
| Compound Name | 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoic acid |
|---|---|
| PubChem CID | 153445319 |
| Molecular Formula | C12H14ClF2NO3 |
| Molecular Weight | 293.70 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-amino-3-(4-chloro-3-propoxyphenyl)-3,3-difluoropropanoic acid |
| SMILES | CCCOc1cc(C(F)(F)C(N)C(=O)O)ccc1Cl |
| InChI | InChI=1S/C12H14ClF2NO3/c1-2-5-19-9-6-7(3-4-8(9)13)12(14,15)10(16)11(17)18/h3-4,6,10H,2,5,16H2,1H3,(H,17,18) |
| InChIKey | WEWZSQDNBSLADC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.70 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |