C16H13F2NO2 — CID 135176100
3,3-difluoro-2-hydroxy-3-(4-phenylmethoxyphenyl)propanenitrile (PubChem CID 135176100) has the molecular formula C16H13F2NO2 and a molecular weight of 289.28 g/mol. Its IUPAC name is 3,3-difluoro-2-hydroxy-3-(4-phenylmethoxyphenyl)propanenitrile.
| Compound Name | 3,3-difluoro-2-hydroxy-3-(4-phenylmethoxyphenyl)propanenitrile |
|---|---|
| PubChem CID | 135176100 |
| Molecular Formula | C16H13F2NO2 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3,3-difluoro-2-hydroxy-3-(4-phenylmethoxyphenyl)propanenitrile |
| SMILES | N#CC(O)C(F)(F)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H13F2NO2/c17-16(18,15(20)10-19)13-6-8-14(9-7-13)21-11-12-4-2-1-3-5-12/h1-9,15,20H,11H2 |
| InChIKey | YBDZSIIRKWKNRL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|