C17H14F2N2O4S — CID 135180886
methyl 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-2-methylsulfanylpyrimidine-4-carboxylate (PubChem CID 135180886) has the molecular formula C17H14F2N2O4S and a molecular weight of 380.37 g/mol. Its IUPAC name is methyl 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-2-methylsulfanylpyrimidine-4-carboxylate.
| Compound Name | methyl 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-2-methylsulfanylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 135180886 |
| Molecular Formula | C17H14F2N2O4S |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | methyl 5-[2-(2,6-difluoro-3,5-dimethoxyphenyl)ethynyl]-2-methylsulfanylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(SC)ncc1C#Cc1c(F)c(OC)cc(OC)c1F |
| InChI | InChI=1S/C17H14F2N2O4S/c1-23-11-7-12(24-2)14(19)10(13(11)18)6-5-9-8-20-17(26-4)21-15(9)16(22)25-3/h7-8H,1-4H3 |
| InChIKey | KTUMHLDFFIPLMS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|