About 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine
5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 135181450) has the molecular formula C5H9FN2S
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
Analyze 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The IUPAC name of 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (CID 135181450) is 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
What is the SMILES notation for 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The canonical SMILES for 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is NC1=NCC(CF)CS1.
What is the InChIKey of 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
The InChIKey is MKQQQLJXYKAGAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FN2S/c6-1-4-2-8-5(7)9-3-4/h4H,1-3H2,(H2,7,8).
What are the key properties of 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine?
5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine has a molecular weight of 148.21 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(fluoromethyl)-5,6-dihydro-4H-1,3-thiazin-2-amine is sourced from PubChem (CID 135181450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).