C20H14ClNO3S — CID 1351827
(4E)-2-(3-chloro-1-benzothiophen-2-yl)-4-[(4-ethoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 1351827) has the molecular formula C20H14ClNO3S and a molecular weight of 383.86 g/mol. Its IUPAC name is (4E)-2-(3-chloro-1-benzothiophen-2-yl)-4-[(4-ethoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(3-chloro-1-benzothiophen-2-yl)-4-[(4-ethoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 1351827 |
| Molecular Formula | C20H14ClNO3S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | (4E)-2-(3-chloro-1-benzothiophen-2-yl)-4-[(4-ethoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | CCOc1ccc(/C=C2/N=C(c3sc4ccccc4c3Cl)OC2=O)cc1 |
| InChI | InChI=1S/C20H14ClNO3S/c1-2-24-13-9-7-12(8-10-13)11-15-20(23)25-19(22-15)18-17(21)14-5-3-4-6-16(14)26-18/h3-11H,2H2,1H3/b15-11+ |
| InChIKey | YBBBAEMQNFGMMH-RVDMUPIBSA-N |
| XLogP | 5.30 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|