C26H18BrClN2O2S — CID 126003395
(5E)-5-[(4-bromophenyl)methylidene]-2-(3-chloro-1-benzothiophen-2-yl)-3-(4-ethoxyphenyl)imidazol-4-one (PubChem CID 126003395) has the molecular formula C26H18BrClN2O2S and a molecular weight of 537.87 g/mol. Its IUPAC name is (5E)-5-[(4-bromophenyl)methylidene]-2-(3-chloro-1-benzothiophen-2-yl)-3-(4-ethoxyphenyl)imidazol-4-one.
| Compound Name | (5E)-5-[(4-bromophenyl)methylidene]-2-(3-chloro-1-benzothiophen-2-yl)-3-(4-ethoxyphenyl)imidazol-4-one |
|---|---|
| PubChem CID | 126003395 |
| Molecular Formula | C26H18BrClN2O2S |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 536.00 |
| IUPAC Name | (5E)-5-[(4-bromophenyl)methylidene]-2-(3-chloro-1-benzothiophen-2-yl)-3-(4-ethoxyphenyl)imidazol-4-one |
| SMILES | CCOc1ccc(N2C(=O)/C(=C\c3ccc(Br)cc3)N=C2c2sc3ccccc3c2Cl)cc1 |
| InChI | InChI=1S/C26H18BrClN2O2S/c1-2-32-19-13-11-18(12-14-19)30-25(24-23(28)20-5-3-4-6-22(20)33-24)29-21(26(30)31)15-16-7-9-17(27)10-8-16/h3-15H,2H2,1H3/b21-15+ |
| InChIKey | NCLGZGGRKUQRRC-RCCKNPSSSA-N |
| XLogP | 7.55 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|