N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid

C9H20N3O3P — CID 135182922

IUPACN,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid
SMILESCCC(=O)N1CCN(P(=O)(O)N(C)C)CC1
InChIInChI=1S/C9H20N3O3P/c1-4-9(13)11-5-7-12(8-6-11)16(14,15)10(2)3/h4-8H2,1-3H3,(H,14,15)
InChIKeyKSTLNIMGDFSPLC-UHFFFAOYSA-N
MW249.25 g/mol
LogP0.20
Rot. Bonds3

About N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid

N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid (PubChem CID 135182922) has the molecular formula C9H20N3O3P and a molecular weight of 249.25 g/mol. Its IUPAC name is N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid.

Molecular Properties

Compound NameN,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid
PubChem CID135182922
Molecular FormulaC9H20N3O3P
Molecular Weight249.25 g/mol
Exact Mass249.12
IUPAC NameN,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid
SMILESCCC(=O)N1CCN(P(=O)(O)N(C)C)CC1
InChIInChI=1S/C9H20N3O3P/c1-4-9(13)11-5-7-12(8-6-11)16(14,15)10(2)3/h4-8H2,1-3H3,(H,14,15)
InChIKeyKSTLNIMGDFSPLC-UHFFFAOYSA-N
XLogP0.20
TPSA64.09 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.25
LogP ≤ 50.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid?
The IUPAC name of N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid (CID 135182922) is N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid.
What is the SMILES notation for N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid?
The canonical SMILES for N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid is CCC(=O)N1CCN(P(=O)(O)N(C)C)CC1.
What is the InChIKey of N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid?
The InChIKey is KSTLNIMGDFSPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N3O3P/c1-4-9(13)11-5-7-12(8-6-11)16(14,15)10(2)3/h4-8H2,1-3H3,(H,14,15).
What are the key properties of N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid?
N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid has a molecular weight of 249.25 g/mol, XLogP of 0.20, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-(4-propanoylpiperazin-1-yl)phosphonamidic acid is sourced from PubChem (CID 135182922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).