C23H29F3N2O4 — CID 135185236
2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)-7,8,9,10-tetrahydrophenanthridine;2,2,2-trifluoroacetic acid (PubChem CID 135185236) has the molecular formula C23H29F3N2O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is 2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)-7,8,9,10-tetrahydrophenanthridine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)-7,8,9,10-tetrahydrophenanthridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 135185236 |
| Molecular Formula | C23H29F3N2O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | 2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)-7,8,9,10-tetrahydrophenanthridine;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc2c3c(cnc2cc1OCCCN1CCCC1)CCCC3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28N2O2.C2HF3O2/c1-24-20-13-18-17-8-3-2-7-16(17)15-22-19(18)14-21(20)25-12-6-11-23-9-4-5-10-23;3-2(4,5)1(6)7/h13-15H,2-12H2,1H3;(H,6,7) |
| InChIKey | OZXMYZSGNXZQEW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|