C27H34F3N3O4 — CID 137479063
N-butan-2-yl-2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-amine;2,2,2-trifluoroacetic acid (PubChem CID 137479063) has the molecular formula C27H34F3N3O4 and a molecular weight of 521.58 g/mol. Its IUPAC name is N-butan-2-yl-2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-butan-2-yl-2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 137479063 |
| Molecular Formula | C27H34F3N3O4 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | N-butan-2-yl-2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCC(C)Nc1c2ccccc2nc2cc(OCCCN3CCCC3)c(OC)cc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H33N3O2.C2HF3O2/c1-4-18(2)26-25-19-10-5-6-11-21(19)27-22-17-24(23(29-3)16-20(22)25)30-15-9-14-28-12-7-8-13-28;3-2(4,5)1(6)7/h5-6,10-11,16-18H,4,7-9,12-15H2,1-3H3,(H,26,27);(H,6,7) |
| InChIKey | PYFGPYNFHUGQBB-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|