C23H27N3O4 — CID 130345731
2-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]acetic acid (PubChem CID 130345731) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]acetic acid.
| Compound Name | 2-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]acetic acid |
|---|---|
| PubChem CID | 130345731 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]acetic acid |
| SMILES | COc1cc2c(NCC(=O)O)c3ccccc3nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C23H27N3O4/c1-29-20-13-17-19(14-21(20)30-12-6-11-26-9-4-5-10-26)25-18-8-3-2-7-16(18)23(17)24-15-22(27)28/h2-3,7-8,13-14H,4-6,9-12,15H2,1H3,(H,24,25)(H,27,28) |
| InChIKey | JXPRPAAEJJILNT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|