C28H33F3N4O5 — CID 130345877
4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 130345877) has the molecular formula C28H33F3N4O5 and a molecular weight of 562.59 g/mol. Its IUPAC name is 4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 130345877 |
| Molecular Formula | C28H33F3N4O5 |
| Molecular Weight | 562.59 g/mol |
| Exact Mass | 562.24 |
| IUPAC Name | 4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc2c(NC3CCNC(=O)C3)c3ccccc3nc2cc1OCCCN1CCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H32N4O3.C2HF3O2/c1-32-23-16-20-22(17-24(23)33-14-6-13-30-11-4-5-12-30)29-21-8-3-2-7-19(21)26(20)28-18-9-10-27-25(31)15-18;3-2(4,5)1(6)7/h2-3,7-8,16-18H,4-6,9-15H2,1H3,(H,27,31)(H,28,29);(H,6,7) |
| InChIKey | DOWLATWXZRHCQY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|