C28H32F3N3O3 — CID 137479087
[(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentyl] 2,2,2-trifluoroacetate (PubChem CID 137479087) has the molecular formula C28H32F3N3O3 and a molecular weight of 515.58 g/mol. Its IUPAC name is [(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137479087 |
| Molecular Formula | C28H32F3N3O3 |
| Molecular Weight | 515.58 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | [(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1cc2c(N[C@@H]3CC[C@H](OC(=O)C(F)(F)F)C3)c3ccccc3nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C28H32F3N3O3/c1-18-15-22-24(17-25(18)36-14-6-13-34-11-4-5-12-34)33-23-8-3-2-7-21(23)26(22)32-19-9-10-20(16-19)37-27(35)28(29,30)31/h2-3,7-8,15,17,19-20H,4-6,9-14,16H2,1H3,(H,32,33)/t19-,20+/m1/s1 |
| InChIKey | PSBPFFPZVZJTSV-UXHICEINSA-N |
| XLogP | 6.00 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|