C25H27ClF3N3O3 — CID 137479002
[2-chloro-9-(propan-2-ylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 137479002) has the molecular formula C25H27ClF3N3O3 and a molecular weight of 509.96 g/mol. Its IUPAC name is [2-chloro-9-(propan-2-ylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [2-chloro-9-(propan-2-ylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 137479002 |
| Molecular Formula | C25H27ClF3N3O3 |
| Molecular Weight | 509.96 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | [2-chloro-9-(propan-2-ylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)Nc1c2ccccc2nc2cc(OCCCN3CCCC3)c(Cl)c(OC(=O)C(F)(F)F)c12 |
| InChI | InChI=1S/C25H27ClF3N3O3/c1-15(2)30-22-16-8-3-4-9-17(16)31-18-14-19(34-13-7-12-32-10-5-6-11-32)21(26)23(20(18)22)35-24(33)25(27,28)29/h3-4,8-9,14-15H,5-7,10-13H2,1-2H3,(H,30,31) |
| InChIKey | XESPWMJPLIGQLK-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.96 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|