C26H33N3O2 — CID 137479021
cis-(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentan-1-ol (PubChem CID 137479021) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentan-1-ol.
| Compound Name | cis-(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 137479021 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | cis-(1S,3R)-3-[[2-methyl-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]cyclopentan-1-ol |
| SMILES | Cc1cc2c(N[C@@H]3CC[C@H](O)C3)c3ccccc3nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C26H33N3O2/c1-18-15-22-24(17-25(18)31-14-6-13-29-11-4-5-12-29)28-23-8-3-2-7-21(23)26(22)27-19-9-10-20(30)16-19/h2-3,7-8,15,17,19-20,30H,4-6,9-14,16H2,1H3,(H,27,28)/t19-,20+/m1/s1 |
| InChIKey | ZZSAZRLRMYQWSU-UXHICEINSA-N |
| XLogP | 4.89 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|