C28H36N4O3 — CID 130345883
1-ethyl-4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one (PubChem CID 130345883) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 1-ethyl-4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one.
| Compound Name | 1-ethyl-4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 130345883 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 1-ethyl-4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one |
| SMILES | CCN1CCC(Nc2c3ccccc3nc3cc(OCCCN4CCCC4)c(OC)cc23)CC1=O |
| InChI | InChI=1S/C28H36N4O3/c1-3-32-15-11-20(17-27(32)33)29-28-21-9-4-5-10-23(21)30-24-19-26(25(34-2)18-22(24)28)35-16-8-14-31-12-6-7-13-31/h4-5,9-10,18-20H,3,6-8,11-17H2,1-2H3,(H,29,30) |
| InChIKey | WUXIXUUWJWMCIV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|