C21H24FN3O2 — CID 130345733
3-[3-(3-fluoroazetidin-1-yl)propoxy]-2-methoxy-N-methylacridin-9-amine (PubChem CID 130345733) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is 3-[3-(3-fluoroazetidin-1-yl)propoxy]-2-methoxy-N-methylacridin-9-amine.
| Compound Name | 3-[3-(3-fluoroazetidin-1-yl)propoxy]-2-methoxy-N-methylacridin-9-amine |
|---|---|
| PubChem CID | 130345733 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 3-[3-(3-fluoroazetidin-1-yl)propoxy]-2-methoxy-N-methylacridin-9-amine |
| SMILES | CNc1c2ccccc2nc2cc(OCCCN3CC(F)C3)c(OC)cc12 |
| InChI | InChI=1S/C21H24FN3O2/c1-23-21-15-6-3-4-7-17(15)24-18-11-20(19(26-2)10-16(18)21)27-9-5-8-25-12-14(22)13-25/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3,(H,23,24) |
| InChIKey | MWNRIEMDVQIPBC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|