C26H32N4O3 — CID 130345878
4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one (PubChem CID 130345878) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one.
| Compound Name | 4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one |
|---|---|
| PubChem CID | 130345878 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 4-[[2-methoxy-3-(3-pyrrolidin-1-ylpropoxy)acridin-9-yl]amino]piperidin-2-one |
| SMILES | COc1cc2c(NC3CCNC(=O)C3)c3ccccc3nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C26H32N4O3/c1-32-23-16-20-22(17-24(23)33-14-6-13-30-11-4-5-12-30)29-21-8-3-2-7-19(21)26(20)28-18-9-10-27-25(31)15-18/h2-3,7-8,16-18H,4-6,9-15H2,1H3,(H,27,31)(H,28,29) |
| InChIKey | WJNCBJOOKAJEEL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|