C22H24ClN3O3 — CID 137478970
[2-chloro-9-(methylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] formate (PubChem CID 137478970) has the molecular formula C22H24ClN3O3 and a molecular weight of 413.91 g/mol. Its IUPAC name is [2-chloro-9-(methylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] formate.
| Compound Name | [2-chloro-9-(methylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] formate |
|---|---|
| PubChem CID | 137478970 |
| Molecular Formula | C22H24ClN3O3 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | [2-chloro-9-(methylamino)-3-(3-pyrrolidin-1-ylpropoxy)acridin-1-yl] formate |
| SMILES | CNc1c2ccccc2nc2cc(OCCCN3CCCC3)c(Cl)c(OC=O)c12 |
| InChI | InChI=1S/C22H24ClN3O3/c1-24-21-15-7-2-3-8-16(15)25-17-13-18(20(23)22(19(17)21)29-14-27)28-12-6-11-26-9-4-5-10-26/h2-3,7-8,13-14H,4-6,9-12H2,1H3,(H,24,25) |
| InChIKey | OTHNIDYDHXVAAN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|