C19H27ClN2O5 — CID 135187648
3-[amino-(3-methyl-2-propan-2-yloxycarbonylbutanoyl)amino]-3-(4-chlorophenyl)-2-methylpropanoic acid (PubChem CID 135187648) has the molecular formula C19H27ClN2O5 and a molecular weight of 398.89 g/mol. Its IUPAC name is 3-[amino-(3-methyl-2-propan-2-yloxycarbonylbutanoyl)amino]-3-(4-chlorophenyl)-2-methylpropanoic acid.
| Compound Name | 3-[amino-(3-methyl-2-propan-2-yloxycarbonylbutanoyl)amino]-3-(4-chlorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 135187648 |
| Molecular Formula | C19H27ClN2O5 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 3-[amino-(3-methyl-2-propan-2-yloxycarbonylbutanoyl)amino]-3-(4-chlorophenyl)-2-methylpropanoic acid |
| SMILES | CC(C)OC(=O)C(C(=O)N(N)C(c1ccc(Cl)cc1)C(C)C(=O)O)C(C)C |
| InChI | InChI=1S/C19H27ClN2O5/c1-10(2)15(19(26)27-11(3)4)17(23)22(21)16(12(5)18(24)25)13-6-8-14(20)9-7-13/h6-12,15-16H,21H2,1-5H3,(H,24,25) |
| InChIKey | VJSCBGGINUMPDY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|