C15H12N6OS — CID 135188012
4-benzyl-6-oxo-2-(2H-tetrazol-5-ylmethylsulfanyl)-1H-pyridine-3-carbonitrile (PubChem CID 135188012) has the molecular formula C15H12N6OS and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-benzyl-6-oxo-2-(2H-tetrazol-5-ylmethylsulfanyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 4-benzyl-6-oxo-2-(2H-tetrazol-5-ylmethylsulfanyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135188012 |
| Molecular Formula | C15H12N6OS |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 4-benzyl-6-oxo-2-(2H-tetrazol-5-ylmethylsulfanyl)-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(Cc2ccccc2)cc(=O)[nH]c1SCc1nn[nH]n1 |
| InChI | InChI=1S/C15H12N6OS/c16-8-12-11(6-10-4-2-1-3-5-10)7-14(22)17-15(12)23-9-13-18-20-21-19-13/h1-5,7H,6,9H2,(H,17,22)(H,18,19,20,21) |
| InChIKey | FYLMMCSEUNXWCJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |