C10H14N4O2S — CID 135191077
(3aR,6aS)-N-(3-oxo-1,2,4-thiadiazol-5-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 135191077) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is (3aR,6aS)-N-(3-oxo-1,2,4-thiadiazol-5-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aR,6aS)-N-(3-oxo-1,2,4-thiadiazol-5-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 135191077 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (3aR,6aS)-N-(3-oxo-1,2,4-thiadiazol-5-yl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | O=C(Nc1nc(=O)[nH]s1)N1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C10H14N4O2S/c15-8-11-9(17-13-8)12-10(16)14-4-6-2-1-3-7(6)5-14/h6-7H,1-5H2,(H2,11,12,13,15,16)/t6-,7+ |
| InChIKey | KMFDRTNYIISABC-KNVOCYPGSA-N |
| XLogP | 1.10 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |